Compound Q&A

What industries use 2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7)?

Answer

2,2-Bis(trimethylsilyl)acetamide
2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7) is widely used in various industries. It is an essential reagent in the synthesis of pharmaceuticals and polymers. Additionally, it finds applications in the production of sensors and semiconductors, where its stabilizing properties are particularly valuable.

About

CAS No 17879-45-7
English Name 2,2-Bis(trimethylsilyl)acetamide
Molecular Formula C8H21NOSi2
Molecular Weight 203.43399999999994 g/mol
SMILES C[Si](C)(C)C(C(=O)N)[Si](C)(C)C
InChIKey NDVMCQUOSYOQMZ-UHFFFAOYSA-N
Last Updated: 2026-03-22 14:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7)?

2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7) is a colorless, crystalline solid with a molecula...

Compound Q&A

How is 2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7) typically synthesized?

2,2-Bis(trimethylsilyl)acetamide is typically synthesized by the reaction of acetic anhydride with t...

Compound Q&A

What precautions should be taken when handling 2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7)?

When handling 2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7), safety should be a top priority. W...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...