Compound Q&A

How is 9-Hydroxyellipticine hydrochloride (CAS: 52238-35-4) typically synthesized?

Answer

9-Hydroxyellipticine hydrochloride
9-Hydroxyellipticine hydrochloride is usually synthesized by the reaction of 9-hydroxyellipticine with hydrochloric acid. The reaction is typically carried out in a solvent such as methanol or ethanol. The yield is usually around 85-90%, and the product is often purified by recrystallization from appropriate solvents. The use of azeotropic distillation can enhance the yield and purity of the final product.

About

CAS No 52238-35-4
English Name 9-Hydroxyellipticine hydrochloride
Molecular Formula C17H15ClN2O
Molecular Weight 298.77 g/mol
SMILES CC1=C2C=CN=CC2=C(C3=C1NC4=C3C=C(C=C4)O)C.Cl
InChIKey DLDKVFOKLGPVBT-UHFFFAOYSA-N
Last Updated: 2026-03-20 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 9-Hydroxyellipticine hydrochloride (CAS: 52238-35-4)?

9-Hydroxyellipticine hydrochloride is a crystalline compound with a molecular weight of approximatel...

Compound Q&A

What industries use 9-Hydroxyellipticine hydrochloride (CAS: 52238-35-4)?

9-Hydroxyellipticine hydrochloride is primarily used in the pharmaceutical industry due to its poten...

Compound Q&A

What precautions should be taken when handling 9-Hydroxyellipticine hydrochloride (CAS: 52238-35-4)?

When handling 9-Hydroxyellipticine hydrochloride, it is important to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...