Compound Q&A

What are the physical and chemical properties of 9-Hydroxyellipticine hydrochloride (CAS: 52238-35-4)?

Answer

9-Hydroxyellipticine hydrochloride
9-Hydroxyellipticine hydrochloride is a crystalline compound with a molecular weight of approximately 429.87 g/mol. It has a melting point of around 210-212°C and is sparingly soluble in water but readily soluble in organic solvents such as methanol and ethanol. It is relatively stable under normal conditions but can react with bases to form the free base. This compound is commonly used in pharmaceutical research for its potential medicinal properties.

About

CAS No 52238-35-4
English Name 9-Hydroxyellipticine hydrochloride
Molecular Formula C17H15ClN2O
Molecular Weight 298.77 g/mol
SMILES CC1=C2C=CN=CC2=C(C3=C1NC4=C3C=C(C=C4)O)C.Cl
InChIKey DLDKVFOKLGPVBT-UHFFFAOYSA-N
Last Updated: 2026-03-20 10:59

Related Q&A

Compound Q&A

How is 9-Hydroxyellipticine hydrochloride (CAS: 52238-35-4) typically synthesized?

9-Hydroxyellipticine hydrochloride is usually synthesized by the reaction of 9-hydroxyellipticine wi...

Compound Q&A

What industries use 9-Hydroxyellipticine hydrochloride (CAS: 52238-35-4)?

9-Hydroxyellipticine hydrochloride is primarily used in the pharmaceutical industry due to its poten...

Compound Q&A

What precautions should be taken when handling 9-Hydroxyellipticine hydrochloride (CAS: 52238-35-4)?

When handling 9-Hydroxyellipticine hydrochloride, it is important to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...