Compound Q&A

What precautions should be taken when handling Methyl 3-bromo-2,6-dimethoxybenzoate (CAS: 65977-12-0)?

Answer

Methyl 3-bromo-2,6-dimethoxybenzoate
When handling Methyl 3-bromo-2,6-dimethoxybenzoate, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. This compound should be used in a fume hood to minimize exposure to bromine and other reactive moieties. Spills should be cleaned up promptly, and proper waste disposal procedures should be followed. Always consult the Safety Data Sheet (SDS) for detailed safety information.

About

CAS No 65977-12-0
English Name Methyl 3-bromo-2,6-dimethoxybenzoate
Molecular Formula C10H11BrO4
Molecular Weight 275.1 g/mol
SMILES COC1=C(C(=C(C=C1)Br)OC)C(=O)OC
InChIKey IYVSXIFYVRNTDY-UHFFFAOYSA-N
Last Updated: 2026-03-20 06:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-bromo-2,6-dimethoxybenzoate (CAS: 65977-12-0)?

Methyl 3-bromo-2,6-dimethoxybenzoate is a crystalline compound with a molecular weight of approximat...

Compound Q&A

How is Methyl 3-bromo-2,6-dimethoxybenzoate (CAS: 65977-12-0) typically synthesized?

Methyl 3-bromo-2,6-dimethoxybenzoate is commonly synthesized by the reaction of 2,6-dimethoxybenzoic...

Compound Q&A

What industries use Methyl 3-bromo-2,6-dimethoxybenzoate (CAS: 65977-12-0)?

Methyl 3-bromo-2,6-dimethoxybenzoate is primarily used in the pharmaceutical and chemical industries...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...