Compound Q&A

What industries use Methyl 3-bromo-2,6-dimethoxybenzoate (CAS: 65977-12-0)?

Answer

Methyl 3-bromo-2,6-dimethoxybenzoate
Methyl 3-bromo-2,6-dimethoxybenzoate is primarily used in the pharmaceutical and chemical industries as an intermediate. It is employed in the synthesis of drugs and other organic compounds. Additionally, it finds applications in the production of certain dyes and as a reagent in analytical chemistry.

About

CAS No 65977-12-0
English Name Methyl 3-bromo-2,6-dimethoxybenzoate
Molecular Formula C10H11BrO4
Molecular Weight 275.1 g/mol
SMILES COC1=C(C(=C(C=C1)Br)OC)C(=O)OC
InChIKey IYVSXIFYVRNTDY-UHFFFAOYSA-N
Last Updated: 2026-03-20 06:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-bromo-2,6-dimethoxybenzoate (CAS: 65977-12-0)?

Methyl 3-bromo-2,6-dimethoxybenzoate is a crystalline compound with a molecular weight of approximat...

Compound Q&A

How is Methyl 3-bromo-2,6-dimethoxybenzoate (CAS: 65977-12-0) typically synthesized?

Methyl 3-bromo-2,6-dimethoxybenzoate is commonly synthesized by the reaction of 2,6-dimethoxybenzoic...

Compound Q&A

What precautions should be taken when handling Methyl 3-bromo-2,6-dimethoxybenzoate (CAS: 65977-12-0)?

When handling Methyl 3-bromo-2,6-dimethoxybenzoate, it is essential to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...