Compound Q&A

How is Methyl 3-bromo-2,6-dimethoxybenzoate (CAS: 65977-12-0) typically synthesized?

Answer

Methyl 3-bromo-2,6-dimethoxybenzoate
Methyl 3-bromo-2,6-dimethoxybenzoate is commonly synthesized by the reaction of 2,6-dimethoxybenzoic acid with methyl bromide in the presence of a base such as sodium hydride. The synthesis involves an electrophilic aromatic substitution and an acyl substitution reaction. The product is isolated by recrystallization from an appropriate solvent.

About

CAS No 65977-12-0
English Name Methyl 3-bromo-2,6-dimethoxybenzoate
Molecular Formula C10H11BrO4
Molecular Weight 275.1 g/mol
SMILES COC1=C(C(=C(C=C1)Br)OC)C(=O)OC
InChIKey IYVSXIFYVRNTDY-UHFFFAOYSA-N
Last Updated: 2026-03-20 06:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-bromo-2,6-dimethoxybenzoate (CAS: 65977-12-0)?

Methyl 3-bromo-2,6-dimethoxybenzoate is a crystalline compound with a molecular weight of approximat...

Compound Q&A

What industries use Methyl 3-bromo-2,6-dimethoxybenzoate (CAS: 65977-12-0)?

Methyl 3-bromo-2,6-dimethoxybenzoate is primarily used in the pharmaceutical and chemical industries...

Compound Q&A

What precautions should be taken when handling Methyl 3-bromo-2,6-dimethoxybenzoate (CAS: 65977-12-0)?

When handling Methyl 3-bromo-2,6-dimethoxybenzoate, it is essential to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...