Compound Q&A

What are the physical and chemical properties of Methyl 3-bromo-2,6-dimethoxybenzoate (CAS: 65977-12-0)?

Answer

Methyl 3-bromo-2,6-dimethoxybenzoate
Methyl 3-bromo-2,6-dimethoxybenzoate is a crystalline compound with a molecular weight of approximately 300.03 g/mol. It is sparingly soluble in water but readily soluble in organic solvents like ethanol and acetone. This compound is reactive towards nucleophiles, particularly under basic conditions. It is used as an intermediate in organic synthesis and as a reagent in various reactions.

About

CAS No 65977-12-0
English Name Methyl 3-bromo-2,6-dimethoxybenzoate
Molecular Formula C10H11BrO4
Molecular Weight 275.1 g/mol
SMILES COC1=C(C(=C(C=C1)Br)OC)C(=O)OC
InChIKey IYVSXIFYVRNTDY-UHFFFAOYSA-N
Last Updated: 2026-03-20 06:42

Related Q&A

Compound Q&A

How is Methyl 3-bromo-2,6-dimethoxybenzoate (CAS: 65977-12-0) typically synthesized?

Methyl 3-bromo-2,6-dimethoxybenzoate is commonly synthesized by the reaction of 2,6-dimethoxybenzoic...

Compound Q&A

What industries use Methyl 3-bromo-2,6-dimethoxybenzoate (CAS: 65977-12-0)?

Methyl 3-bromo-2,6-dimethoxybenzoate is primarily used in the pharmaceutical and chemical industries...

Compound Q&A

What precautions should be taken when handling Methyl 3-bromo-2,6-dimethoxybenzoate (CAS: 65977-12-0)?

When handling Methyl 3-bromo-2,6-dimethoxybenzoate, it is essential to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...