Compound Q&A

What precautions should be taken when handling 1,2-Dihydro Dexamethasone (CAS: 426-17-5)?

Answer

1,2-Dihydro Dexamethasone
When handling 1,2-Dihydro Dexamethasone, it is crucial to use personal protective equipment (PPE) such as gloves and safety goggles. Work in a well-ventilated area or fume hood to minimize exposure. Spills should be cleaned up using appropriate procedures as outlined in the Safety Data Sheet (SDS).

About

CAS No 426-17-5
English Name 1,2-Dihydro Dexamethasone
Molecular Formula C22H31FO5
Molecular Weight 394.48 g/mol
SMILES C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)[C@@]1(O)C(=O)CO
InChIKey YYZXYYHUGHQGHI-CXSFZGCWSA-N
Last Updated: 2026-03-20 02:47

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2-Dihydro Dexamethasone (CAS: 426-17-5)?

1,2-Dihydro Dexamethasone is a white crystalline powder with a molecular weight of approximately 476...

Compound Q&A

How is 1,2-Dihydro Dexamethasone (CAS: 426-17-5) typically synthesized?

1,2-Dihydro Dexamethasone is typically synthesized by reducing dexamethasone with sodium borohydride...

Compound Q&A

What industries use 1,2-Dihydro Dexamethasone (CAS: 426-17-5)?

1,2-Dihydro Dexamethasone is primarily used in the pharmaceutical industry for the production of cor...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...