Compound Q&A

What are the physical and chemical properties of 1,2-Dihydro Dexamethasone (CAS: 426-17-5)?

Answer

1,2-Dihydro Dexamethasone
1,2-Dihydro Dexamethasone is a white crystalline powder with a molecular weight of approximately 476.65 g/mol. It is slightly soluble in water and ethanol. Chemically, it is highly reactive due to the presence of functional groups such as the hydroxyl and methyl groups. It undergoes hydrolysis and oxidation readily.

About

CAS No 426-17-5
English Name 1,2-Dihydro Dexamethasone
Molecular Formula C22H31FO5
Molecular Weight 394.48 g/mol
SMILES C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)[C@@]1(O)C(=O)CO
InChIKey YYZXYYHUGHQGHI-CXSFZGCWSA-N
Last Updated: 2026-03-20 02:47

Related Q&A

Compound Q&A

How is 1,2-Dihydro Dexamethasone (CAS: 426-17-5) typically synthesized?

1,2-Dihydro Dexamethasone is typically synthesized by reducing dexamethasone with sodium borohydride...

Compound Q&A

What industries use 1,2-Dihydro Dexamethasone (CAS: 426-17-5)?

1,2-Dihydro Dexamethasone is primarily used in the pharmaceutical industry for the production of cor...

Compound Q&A

What precautions should be taken when handling 1,2-Dihydro Dexamethasone (CAS: 426-17-5)?

When handling 1,2-Dihydro Dexamethasone, it is crucial to use personal protective equipment (PPE) su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...