Compound Q&A

What industries use Ethyl 2-(6-quinolinyl)propanoate (CAS: 1193317-61-1)?

Answer

Ethyl 2-(6-quinolinyl)propanoate
Ethyl 2-(6-quinolinyl)propanoate (CAS: 1193317-61-1) is used in the pharmaceutical industry as a precursor for the synthesis of certain quinoline-based drugs. It is also utilized in the production of functional materials such as sensors and semiconductors due to its electronic properties. Additionally, it is employed in the polymer industry for the modification of polymer properties and in the development of new polymer-based materials.

About

English Name Ethyl 2-(6-quinolinyl)propanoate
Molecular Formula C14H15NO2
Molecular Weight 229.28 g/mol
SMILES CCOC(=O)C(C)c1ccc2c(c1)cccn2
InChIKey WEXDXTGMVWYWLX-UHFFFAOYSA-N
Last Updated: 2026-03-19 14:17

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-(6-quinolinyl)propanoate (CAS: 1193317-61-1)?

Ethyl 2-(6-quinolinyl)propanoate (CAS: 1193317-61-1) is a colorless to light yellow liquid with a mo...

Compound Q&A

How is Ethyl 2-(6-quinolinyl)propanoate (CAS: 1193317-61-1) typically synthesized?

Ethyl 2-(6-quinolinyl)propanoate (CAS: 1193317-61-1) is typically synthesized by the reaction of 2-b...

Compound Q&A

What precautions should be taken when handling Ethyl 2-(6-quinolinyl)propanoate (CAS: 1193317-61-1)?

When handling Ethyl 2-(6-quinolinyl)propanoate (CAS: 1193317-61-1), appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...