Compound Q&A

How is Ethyl 2-(6-quinolinyl)propanoate (CAS: 1193317-61-1) typically synthesized?

Answer

Ethyl 2-(6-quinolinyl)propanoate
Ethyl 2-(6-quinolinyl)propanoate (CAS: 1193317-61-1) is typically synthesized by the reaction of 2-bromopropanol with 6-quinolinecarboxylic acid in the presence of a base like potassium carbonate. The reaction is carried out in an organic solvent such as dimethylformamide (DMF) at elevated temperatures, typically around 80°C. Stoichiometric amounts of the reagents and appropriate catalysts are used to achieve high yields and good selectivity.

About

English Name Ethyl 2-(6-quinolinyl)propanoate
Molecular Formula C14H15NO2
Molecular Weight 229.28 g/mol
SMILES CCOC(=O)C(C)c1ccc2c(c1)cccn2
InChIKey WEXDXTGMVWYWLX-UHFFFAOYSA-N
Last Updated: 2026-03-19 14:17

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-(6-quinolinyl)propanoate (CAS: 1193317-61-1)?

Ethyl 2-(6-quinolinyl)propanoate (CAS: 1193317-61-1) is a colorless to light yellow liquid with a mo...

Compound Q&A

What industries use Ethyl 2-(6-quinolinyl)propanoate (CAS: 1193317-61-1)?

Ethyl 2-(6-quinolinyl)propanoate (CAS: 1193317-61-1) is used in the pharmaceutical industry as a pre...

Compound Q&A

What precautions should be taken when handling Ethyl 2-(6-quinolinyl)propanoate (CAS: 1193317-61-1)?

When handling Ethyl 2-(6-quinolinyl)propanoate (CAS: 1193317-61-1), appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...