Compound Q&A

What are the physical and chemical properties of Ethyl 2-(6-quinolinyl)propanoate (CAS: 1193317-61-1)?

Answer

Ethyl 2-(6-quinolinyl)propanoate
Ethyl 2-(6-quinolinyl)propanoate (CAS: 1193317-61-1) is a colorless to light yellow liquid with a molecular weight of approximately 232.29 g/mol. It has a high solubility in organic solvents like ethanol and acetone but is practically insoluble in water. The compound is moderately reactive towards nucleophiles and can undergo ester hydrolysis under acidic or basic conditions. It is stable under normal storage conditions but should be protected from moisture and light.

About

English Name Ethyl 2-(6-quinolinyl)propanoate
Molecular Formula C14H15NO2
Molecular Weight 229.28 g/mol
SMILES CCOC(=O)C(C)c1ccc2c(c1)cccn2
InChIKey WEXDXTGMVWYWLX-UHFFFAOYSA-N
Last Updated: 2026-03-19 14:17

Related Q&A

Compound Q&A

How is Ethyl 2-(6-quinolinyl)propanoate (CAS: 1193317-61-1) typically synthesized?

Ethyl 2-(6-quinolinyl)propanoate (CAS: 1193317-61-1) is typically synthesized by the reaction of 2-b...

Compound Q&A

What industries use Ethyl 2-(6-quinolinyl)propanoate (CAS: 1193317-61-1)?

Ethyl 2-(6-quinolinyl)propanoate (CAS: 1193317-61-1) is used in the pharmaceutical industry as a pre...

Compound Q&A

What precautions should be taken when handling Ethyl 2-(6-quinolinyl)propanoate (CAS: 1193317-61-1)?

When handling Ethyl 2-(6-quinolinyl)propanoate (CAS: 1193317-61-1), appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...