Compound Q&A

What precautions should be taken when handling (S)-Alogliptin (CAS: 1108732-05-3)?

Answer

(S)-Alogliptin
When handling (S)-Alogliptin, it is essential to use personal protective equipment (PPE) such as gloves and safety glasses. It should be stored in a cool, dry place away from direct sunlight. In case of a spill, use appropriate absorbent materials and follow local waste disposal regulations. Always refer to the safety data sheet (SDS) for detailed handling and disposal information to ensure safe laboratory practice.

About

English Name (S)-Alogliptin
Molecular Formula C18H21N5O2
Molecular Weight 339.39 g/mol
SMILES CN1C(=O)C=C(N(C1=O)CC2=CC=CC=C2C#N)N3CCCC(C3)N
InChIKey KEJICOXJTRHYAK-UHFFFAOYSA-N
Last Updated: 2026-03-17 15:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-Alogliptin (CAS: 1108732-05-3)?

(S)-Alogliptin is a white to off-white solid with a molecular weight of approximately 332.3 g/mol. I...

Compound Q&A

How is (S)-Alogliptin (CAS: 1108732-05-3) typically synthesized?

(S)-Alogliptin is typically synthesized through asymmetric synthesis. The key step involves the use ...

Compound Q&A

What industries use (S)-Alogliptin (CAS: 1108732-05-3)?

(S)-Alogliptin is primarily used in the pharmaceutical industry, where it serves as an active pharma...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...