Compound Q&A

How is (S)-Alogliptin (CAS: 1108732-05-3) typically synthesized?

Answer

(S)-Alogliptin
(S)-Alogliptin is typically synthesized through asymmetric synthesis. The key step involves the use of chiral auxiliaries and organocatalysts to achieve high enantiomeric excess. The synthetic route involves a series of reactions including alkylation, reduction, and chemical modification to introduce the necessary functional groups and chirality. The overall process yields (S)-Alogliptin with high purity and selectivity.

About

English Name (S)-Alogliptin
Molecular Formula C18H21N5O2
Molecular Weight 339.39 g/mol
SMILES CN1C(=O)C=C(N(C1=O)CC2=CC=CC=C2C#N)N3CCCC(C3)N
InChIKey KEJICOXJTRHYAK-UHFFFAOYSA-N
Last Updated: 2026-03-17 15:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-Alogliptin (CAS: 1108732-05-3)?

(S)-Alogliptin is a white to off-white solid with a molecular weight of approximately 332.3 g/mol. I...

Compound Q&A

What industries use (S)-Alogliptin (CAS: 1108732-05-3)?

(S)-Alogliptin is primarily used in the pharmaceutical industry, where it serves as an active pharma...

Compound Q&A

What precautions should be taken when handling (S)-Alogliptin (CAS: 1108732-05-3)?

When handling (S)-Alogliptin, it is essential to use personal protective equipment (PPE) such as glo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...