Compound Q&A

What are the physical and chemical properties of (S)-Alogliptin (CAS: 1108732-05-3)?

Answer

(S)-Alogliptin
(S)-Alogliptin is a white to off-white solid with a molecular weight of approximately 332.3 g/mol. It has low water solubility, making it poorly soluble in water and more soluble in organic solvents like ethanol and methanol. Chemically, it is reactive towards reducing agents and can undergo hydrolysis under basic conditions. It is a potent inhibitor of dipeptidyl peptidase-4 (DPP-4) with high specificity and selectivity.

About

English Name (S)-Alogliptin
Molecular Formula C18H21N5O2
Molecular Weight 339.39 g/mol
SMILES CN1C(=O)C=C(N(C1=O)CC2=CC=CC=C2C#N)N3CCCC(C3)N
InChIKey KEJICOXJTRHYAK-UHFFFAOYSA-N
Last Updated: 2026-03-17 15:30

Related Q&A

Compound Q&A

How is (S)-Alogliptin (CAS: 1108732-05-3) typically synthesized?

(S)-Alogliptin is typically synthesized through asymmetric synthesis. The key step involves the use ...

Compound Q&A

What industries use (S)-Alogliptin (CAS: 1108732-05-3)?

(S)-Alogliptin is primarily used in the pharmaceutical industry, where it serves as an active pharma...

Compound Q&A

What precautions should be taken when handling (S)-Alogliptin (CAS: 1108732-05-3)?

When handling (S)-Alogliptin, it is essential to use personal protective equipment (PPE) such as glo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...