Compound Q&A

What industries use 2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride (CAS: 90942-38-4)?

Answer

2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride
2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride (CAS: 90942-38-4) is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It is also utilized in the formulation of some pesticides and herbicides. Additionally, it can be used in research for the development of new materials and sensors.

About

CAS No 90942-38-4
English Name 2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride
Molecular Formula C9H11Cl2N
Molecular Weight 204.1 g/mol
SMILES C1C(C1N)C2=CC(=CC=C2)Cl.Cl
InChIKey QRDJNIKTHWYMIN-UHFFFAOYSA-N
Last Updated: 2026-03-17 06:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride (CAS: 90942-38-4)?

2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride (CAS: 90942-38-4) is a white crystalline solid w...

Compound Q&A

How is 2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride (CAS: 90942-38-4) typically synthesized?

2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride (CAS: 90942-38-4) is typically synthesized throu...

Compound Q&A

What precautions should be taken when handling 2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride (CAS: 90942-38-4)?

When handling 2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride (CAS: 90942-38-4), it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...