Compound Q&A

How is 2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride (CAS: 90942-38-4) typically synthesized?

Answer

2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride
2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride (CAS: 90942-38-4) is typically synthesized through a multi-step process involving the protection of a phenolic hydroxyl group, followed by the introduction of a cyclopropanation step, and then the formation of the amine and hydrochloride salt. Common solvents for these reactions include dichloromethane and acetonitrile, and the yield can range from 60% to 80%.

About

CAS No 90942-38-4
English Name 2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride
Molecular Formula C9H11Cl2N
Molecular Weight 204.1 g/mol
SMILES C1C(C1N)C2=CC(=CC=C2)Cl.Cl
InChIKey QRDJNIKTHWYMIN-UHFFFAOYSA-N
Last Updated: 2026-03-17 06:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride (CAS: 90942-38-4)?

2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride (CAS: 90942-38-4) is a white crystalline solid w...

Compound Q&A

What industries use 2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride (CAS: 90942-38-4)?

2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride (CAS: 90942-38-4) is primarily used in the pharm...

Compound Q&A

What precautions should be taken when handling 2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride (CAS: 90942-38-4)?

When handling 2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride (CAS: 90942-38-4), it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...