Compound Q&A

What are the physical and chemical properties of 2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride (CAS: 90942-38-4)?

Answer

2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride
2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride (CAS: 90942-38-4) is a white crystalline solid with a molecular weight of approximately 222.03 g/mol. It has a low melting point and excellent solubility in water and organic solvents. This compound is known for its basic properties and can react with acids to form the free amine. It is stable under normal conditions but should be stored away from strong acids and bases.

About

CAS No 90942-38-4
English Name 2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride
Molecular Formula C9H11Cl2N
Molecular Weight 204.1 g/mol
SMILES C1C(C1N)C2=CC(=CC=C2)Cl.Cl
InChIKey QRDJNIKTHWYMIN-UHFFFAOYSA-N
Last Updated: 2026-03-17 06:03

Related Q&A

Compound Q&A

How is 2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride (CAS: 90942-38-4) typically synthesized?

2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride (CAS: 90942-38-4) is typically synthesized throu...

Compound Q&A

What industries use 2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride (CAS: 90942-38-4)?

2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride (CAS: 90942-38-4) is primarily used in the pharm...

Compound Q&A

What precautions should be taken when handling 2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride (CAS: 90942-38-4)?

When handling 2-(3-Chlorophenyl)cyclopropan-1-amine hydrochloride (CAS: 90942-38-4), it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...