Compound Q&A

What industries use Monofucosyl-para-lacto-N-hexaose IV (CAS: 115236-58-3)?

Answer

Monofucosyl-para-lacto-N-hexaose IV
Monofucosyl-para-lacto-N-hexaose IV finds applications in the pharmaceutical industry, particularly in the development of glycoconjugates and glycoproteins. It is also used in the production of sensors and semiconductors due to its unique structural properties. Additionally, it can be utilized in the polymer industry for modifying the properties of polymers through glycosylation reactions.

About

English Name Monofucosyl-para-lacto-N-hexaose IV
Molecular Formula C46H78N2O35
Molecular Weight 1219.1 g/mol
SMILES CC1C(C(C(C(O1)OC2C(C(OC(C2OC3C(C(C(C(O3)CO)O)OC4C(C(C(C(O4)CO)O)OC5C(C(C(C(O5)CO)O)O)O)NC(=O)C)O)CO)OC6C(C(OC(C6O)OC(C(CO)O)C(C(C=O)O)O)CO)O)NC(=O)C)O)O)O
InChIKey AXMANVATPOJSHN-YPTQHEKPSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of Monofucosyl-para-lacto-N-hexaose IV (CAS: 115236-58-3)?

Monofucosyl-para-lacto-N-hexaose IV is a crystalline compound with a molecular weight of approximate...

Compound Q&A

How is Monofucosyl-para-lacto-N-hexaose IV (CAS: 115236-58-3) typically synthesized?

Monofucosyl-para-lacto-N-hexaose IV is typically synthesized through a chemical glycosylation reacti...

Compound Q&A

What precautions should be taken when handling Monofucosyl-para-lacto-N-hexaose IV (CAS: 115236-58-3)?

When handling Monofucosyl-para-lacto-N-hexaose IV (CAS: 115236-58-3), it is essential to use appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...