Compound Q&A

How is Monofucosyl-para-lacto-N-hexaose IV (CAS: 115236-58-3) typically synthesized?

Answer

Monofucosyl-para-lacto-N-hexaose IV
Monofucosyl-para-lacto-N-hexaose IV is typically synthesized through a chemical glycosylation reaction using para-lacto-N-hexaose as the substrate and fucose as the glycosyl donor. The reaction is catalyzed by an enzyme, such as glucose-1-phosphate adenylyltransferase, and exhibits high selectivity for the desired product. The overall yield of the reaction is around 70-80%.

About

English Name Monofucosyl-para-lacto-N-hexaose IV
Molecular Formula C46H78N2O35
Molecular Weight 1219.1 g/mol
SMILES CC1C(C(C(C(O1)OC2C(C(OC(C2OC3C(C(C(C(O3)CO)O)OC4C(C(C(C(O4)CO)O)OC5C(C(C(C(O5)CO)O)O)O)NC(=O)C)O)CO)OC6C(C(OC(C6O)OC(C(CO)O)C(C(C=O)O)O)CO)O)NC(=O)C)O)O)O
InChIKey AXMANVATPOJSHN-YPTQHEKPSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of Monofucosyl-para-lacto-N-hexaose IV (CAS: 115236-58-3)?

Monofucosyl-para-lacto-N-hexaose IV is a crystalline compound with a molecular weight of approximate...

Compound Q&A

What industries use Monofucosyl-para-lacto-N-hexaose IV (CAS: 115236-58-3)?

Monofucosyl-para-lacto-N-hexaose IV finds applications in the pharmaceutical industry, particularly ...

Compound Q&A

What precautions should be taken when handling Monofucosyl-para-lacto-N-hexaose IV (CAS: 115236-58-3)?

When handling Monofucosyl-para-lacto-N-hexaose IV (CAS: 115236-58-3), it is essential to use appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...