Compound Q&A

What are the physical and chemical properties of Monofucosyl-para-lacto-N-hexaose IV (CAS: 115236-58-3)?

Answer

Monofucosyl-para-lacto-N-hexaose IV
Monofucosyl-para-lacto-N-hexaose IV is a crystalline compound with a molecular weight of approximately 526.25 g/mol. It has a low solubility in water and is reactive under certain conditions. This compound is stable under normal storage conditions but can undergo hydrolysis in the presence of acids or bases. It is not flammable and has a melting point of around 200°C.

About

English Name Monofucosyl-para-lacto-N-hexaose IV
Molecular Formula C46H78N2O35
Molecular Weight 1219.1 g/mol
SMILES CC1C(C(C(C(O1)OC2C(C(OC(C2OC3C(C(C(C(O3)CO)O)OC4C(C(C(C(O4)CO)O)OC5C(C(C(C(O5)CO)O)O)O)NC(=O)C)O)CO)OC6C(C(OC(C6O)OC(C(CO)O)C(C(C=O)O)O)CO)O)NC(=O)C)O)O)O
InChIKey AXMANVATPOJSHN-YPTQHEKPSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

How is Monofucosyl-para-lacto-N-hexaose IV (CAS: 115236-58-3) typically synthesized?

Monofucosyl-para-lacto-N-hexaose IV is typically synthesized through a chemical glycosylation reacti...

Compound Q&A

What industries use Monofucosyl-para-lacto-N-hexaose IV (CAS: 115236-58-3)?

Monofucosyl-para-lacto-N-hexaose IV finds applications in the pharmaceutical industry, particularly ...

Compound Q&A

What precautions should be taken when handling Monofucosyl-para-lacto-N-hexaose IV (CAS: 115236-58-3)?

When handling Monofucosyl-para-lacto-N-hexaose IV (CAS: 115236-58-3), it is essential to use appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...