Compound Q&A

What precautions should be taken when handling Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate (CAS: 885269-81-8)?

Answer

Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate
When handling Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate, it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a well-ventilated area or a fume hood to minimize exposure. Spills should be cleaned up carefully using appropriate absorbents, and the area should be thoroughly washed down. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

English Name Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate
Molecular Formula C13H18N2O3
Molecular Weight 250.3 g/mol
SMILES CC(C)(C)OC(=O)NCC(=O)CC1=CC=NC=C1
InChIKey DWNYQYHSIULYCR-UHFFFAOYSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate (CAS: 885269-81-8)?

Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate has a crystalline form with a molecular weight of...

Compound Q&A

How is Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate (CAS: 885269-81-8) typically synthesized?

Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate is typically synthesized through a multistep proc...

Compound Q&A

What industries use Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate (CAS: 885269-81-8)?

Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate is primarily used in the pharmaceutical industry ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...