Compound Q&A

What industries use Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate (CAS: 885269-81-8)?

Answer

Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate
Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate is primarily used in the pharmaceutical industry as a synthetic intermediate in the production of various therapeutic agents. It also finds applications in the polymer industry for the development of novel materials. Additionally, it can be used in sensor and semiconductor manufacturing due to its chemical reactivity and stability.

About

English Name Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate
Molecular Formula C13H18N2O3
Molecular Weight 250.3 g/mol
SMILES CC(C)(C)OC(=O)NCC(=O)CC1=CC=NC=C1
InChIKey DWNYQYHSIULYCR-UHFFFAOYSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate (CAS: 885269-81-8)?

Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate has a crystalline form with a molecular weight of...

Compound Q&A

How is Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate (CAS: 885269-81-8) typically synthesized?

Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate is typically synthesized through a multistep proc...

Compound Q&A

What precautions should be taken when handling Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate (CAS: 885269-81-8)?

When handling Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate, it is essential to use appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...