Compound Q&A

How is Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate (CAS: 885269-81-8) typically synthesized?

Answer

Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate
Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate is typically synthesized through a multistep procedure involving the reaction of tert-butyl isothiocyanate and 2-oxo-3-(pyridin-4-yl)propylamine. The synthesis involves the use of acetic anhydride as a solvent and typically yields around 70-80% of the desired product. The reaction is monitored by TLC or HPLC to ensure selectivity and purity.

About

English Name Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate
Molecular Formula C13H18N2O3
Molecular Weight 250.3 g/mol
SMILES CC(C)(C)OC(=O)NCC(=O)CC1=CC=NC=C1
InChIKey DWNYQYHSIULYCR-UHFFFAOYSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate (CAS: 885269-81-8)?

Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate has a crystalline form with a molecular weight of...

Compound Q&A

What industries use Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate (CAS: 885269-81-8)?

Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate is primarily used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate (CAS: 885269-81-8)?

When handling Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate, it is essential to use appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...