Compound Q&A

What are the physical and chemical properties of Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate (CAS: 885269-81-8)?

Answer

Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate
Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate has a crystalline form with a molecular weight of approximately 327.36 g/mol. It is slightly soluble in water but soluble in common organic solvents like ethanol and acetone. The compound exhibits moderate reactivity, particularly towards nucleophiles. It is stable under normal conditions but should be stored in a cool, dry place away from direct sunlight.

About

English Name Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate
Molecular Formula C13H18N2O3
Molecular Weight 250.3 g/mol
SMILES CC(C)(C)OC(=O)NCC(=O)CC1=CC=NC=C1
InChIKey DWNYQYHSIULYCR-UHFFFAOYSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

How is Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate (CAS: 885269-81-8) typically synthesized?

Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate is typically synthesized through a multistep proc...

Compound Q&A

What industries use Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate (CAS: 885269-81-8)?

Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate is primarily used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate (CAS: 885269-81-8)?

When handling Tert-butyl (2-oxo-3-(pyridin-4-yl)propyl)carbamate, it is essential to use appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...