Compound Q&A

What industries use 5-Bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole (CAS: 850375-27-8)?

Answer

5-Bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole
5-Bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole finds application in pharmaceuticals, where it serves as an intermediate in the synthesis of drugs. It is also used in the development of sensors and semiconductors due to its unique electronic properties. The compound's stability and reactivity make it a valuable tool in polymer chemistry for functionalizing materials.

About

English Name 5-Bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole
Molecular Formula C11H7BrF3NS
Molecular Weight 322.15 g/mol
SMILES Cc1c(sc(n1)c2ccc(cc2)C(F)(F)F)Br
InChIKey BZCIYGNYGIKEEC-UHFFFAOYSA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole (CAS: 850375-27-8)?

5-Bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole is a crystalline solid with a molecular ...

Compound Q&A

How is 5-Bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole (CAS: 850375-27-8) typically synthesized?

5-Bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole can be synthesized through a multi-step ...

Compound Q&A

What precautions should be taken when handling 5-Bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole (CAS: 850375-27-8)?

When handling 5-Bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole, it is crucial to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...