Compound Q&A

What are the physical and chemical properties of 5-Bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole (CAS: 850375-27-8)?

Answer

5-Bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole
5-Bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole is a crystalline solid with a molecular weight of approximately 349.02 g/mol. It has a high melting point and is slightly soluble in common organic solvents. The compound is reactive towards nucleophiles and can undergo substitution reactions. It is stable under normal storage conditions but should be protected from moisture and heat.

About

English Name 5-Bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole
Molecular Formula C11H7BrF3NS
Molecular Weight 322.15 g/mol
SMILES Cc1c(sc(n1)c2ccc(cc2)C(F)(F)F)Br
InChIKey BZCIYGNYGIKEEC-UHFFFAOYSA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

How is 5-Bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole (CAS: 850375-27-8) typically synthesized?

5-Bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole can be synthesized through a multi-step ...

Compound Q&A

What industries use 5-Bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole (CAS: 850375-27-8)?

5-Bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole finds application in pharmaceuticals, wh...

Compound Q&A

What precautions should be taken when handling 5-Bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole (CAS: 850375-27-8)?

When handling 5-Bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole, it is crucial to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...