Compound Q&A

What industries use Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate (CAS: 691856-86-7)?

Answer

Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate
Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate finds application in the pharmaceutical industry for the development of new drugs, particularly in cancer research and treatment. It is also used in the synthesis of sensor materials and as a building block in the development of novel materials such as polymers and semiconductors.

About

English Name Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate
Molecular Formula C17H13FO4
Molecular Weight 300.29 g/mol
SMILES CCOC(=O)C1=C(OC2=C1C=C(C=C2)O)C3=CC=C(C=C3)F
InChIKey PCOIFIVNARQEPO-UHFFFAOYSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate (CAS: 691856-86-7)?

Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate is a crystalline compound with a molec...

Compound Q&A

How is Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate (CAS: 691856-86-7) typically synthesized?

Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate is typically synthesized via a multist...

Compound Q&A

What precautions should be taken when handling Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate (CAS: 691856-86-7)?

When handling Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate, it is crucial to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...