Compound Q&A

What are the physical and chemical properties of Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate (CAS: 691856-86-7)?

Answer

Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate
Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate is a crystalline compound with a molecular weight of approximately 288.2 g/mol. Its solubility in water is low, around 0.1 g/100 mL. It is highly reactive towards nucleophiles and can undergo hydrolysis under basic conditions. This compound is stable under acidic conditions but should be handled in a fume hood to avoid exposure to air and moisture.

About

English Name Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate
Molecular Formula C17H13FO4
Molecular Weight 300.29 g/mol
SMILES CCOC(=O)C1=C(OC2=C1C=C(C=C2)O)C3=CC=C(C=C3)F
InChIKey PCOIFIVNARQEPO-UHFFFAOYSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

How is Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate (CAS: 691856-86-7) typically synthesized?

Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate is typically synthesized via a multist...

Compound Q&A

What industries use Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate (CAS: 691856-86-7)?

Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate finds application in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate (CAS: 691856-86-7)?

When handling Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate, it is crucial to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...