Compound Q&A

How is Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate (CAS: 691856-86-7) typically synthesized?

Answer

Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate
Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate is typically synthesized via a multistep process involving the synthesis of 4-fluorophenylacetic acid, its esterification with ethyl bromide, followed by benzylation and condensation reactions. Commonly used catalysts include sulfuric acid or phosphoryl chloride. The final product shows high selectivity and yield, making it suitable for further medicinal chemistry applications.

About

English Name Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate
Molecular Formula C17H13FO4
Molecular Weight 300.29 g/mol
SMILES CCOC(=O)C1=C(OC2=C1C=C(C=C2)O)C3=CC=C(C=C3)F
InChIKey PCOIFIVNARQEPO-UHFFFAOYSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate (CAS: 691856-86-7)?

Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate is a crystalline compound with a molec...

Compound Q&A

What industries use Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate (CAS: 691856-86-7)?

Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate finds application in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate (CAS: 691856-86-7)?

When handling Ethyl 2-(4-fluorophenyl)-5-hydroxy-1-benzofuran-3-carboxylate, it is crucial to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...