Compound Q&A

What precautions should be taken when handling 1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0)?

Answer

1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide
When handling 1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0), appropriate personal protective equipment (PPE) should be worn, including gloves, lab coat, and safety goggles. The compound should be handled in a well-ventilated area or within a fume hood. In case of a spill, immediately clean up the area using appropriate absorbent materials and ensure proper disposal of waste. Refer to the safety data sheet (SDS) for detailed handling and disposal procedures.

About

English Name 1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide
Molecular Formula C18H20BrN
Molecular Weight 330.3 g/mol
SMILES CC1=[N+](C2=C(C1(C)CC=C)C3=CC=CC=C3C=C2)C.[Br-]
InChIKey XQNGBNKGPFPTIL-UHFFFAOYSA-M
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0)?

1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0) is a crystalline solid with a...

Compound Q&A

How is 1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0) typically synthesized?

1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide is typically synthesized through a multi-step pr...

Compound Q&A

What industries use 1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0)?

1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0) is used in the pharmaceutical...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...