Compound Q&A

How is 1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0) typically synthesized?

Answer

1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide
1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide is typically synthesized through a multi-step process involving the reaction of 1,2,3-trimethyl-1H-benzo[e]indole with allyl bromide in the presence of a base like potassium carbonate. The reaction is carried out in an inert solvent such as dimethylformamide (DMF) under standard conditions. Yield is generally around 70-80%, with good selectivity towards the desired product.

About

English Name 1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide
Molecular Formula C18H20BrN
Molecular Weight 330.3 g/mol
SMILES CC1=[N+](C2=C(C1(C)CC=C)C3=CC=CC=C3C=C2)C.[Br-]
InChIKey XQNGBNKGPFPTIL-UHFFFAOYSA-M
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0)?

1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0) is a crystalline solid with a...

Compound Q&A

What industries use 1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0)?

1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0) is used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling 1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0)?

When handling 1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0), appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...