Compound Q&A

What are the physical and chemical properties of 1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0)?

Answer

1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide
1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0) is a crystalline solid with a molecular weight of approximately 328.07 g/mol. It has a low solubility in water but is soluble in organic solvents such as ethanol and acetone. The compound shows moderate reactivity towards nucleophiles and electrophiles. It is stable under normal conditions but should be stored in a cool, dry place away from direct sunlight and heat sources.

About

English Name 1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide
Molecular Formula C18H20BrN
Molecular Weight 330.3 g/mol
SMILES CC1=[N+](C2=C(C1(C)CC=C)C3=CC=CC=C3C=C2)C.[Br-]
InChIKey XQNGBNKGPFPTIL-UHFFFAOYSA-M
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

How is 1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0) typically synthesized?

1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide is typically synthesized through a multi-step pr...

Compound Q&A

What industries use 1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0)?

1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0) is used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling 1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0)?

When handling 1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0), appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...