Compound Q&A

What industries use 1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0)?

Answer

1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide
1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0) is used in the pharmaceutical industry for the synthesis of certain drugs and in the research of new compounds. It also finds application in the semiconductor industry for doping purposes and in the development of organic semiconductors. Additionally, it is utilized in the production of organic electronic materials and sensors.

About

English Name 1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide
Molecular Formula C18H20BrN
Molecular Weight 330.3 g/mol
SMILES CC1=[N+](C2=C(C1(C)CC=C)C3=CC=CC=C3C=C2)C.[Br-]
InChIKey XQNGBNKGPFPTIL-UHFFFAOYSA-M
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0)?

1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0) is a crystalline solid with a...

Compound Q&A

How is 1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0) typically synthesized?

1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide is typically synthesized through a multi-step pr...

Compound Q&A

What precautions should be taken when handling 1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0)?

When handling 1-Allyl-1,2,3-trimethyl-1H-benzo[e]indolium bromide (CAS: 891503-79-0), appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...