Compound Q&A

What industries use Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate (CAS: 90407-15-1)?

Answer

Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate
Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate (CAS: 90407-15-1) finds applications in the pharmaceutical and chemical industries. It serves as a key intermediate in the synthesis of various drug candidates, particularly those targeting specific enzymes or receptors. Additionally, it is utilized in the development of sensors and materials due to its unique chemical properties.

About

CAS No 90407-15-1
English Name Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate
Molecular Formula C11H9ClO2S
Molecular Weight 240.71099999999996 g/mol
SMILES CCOC(=O)C1=CC2=C(S1)C(=CC=C2)Cl
InChIKey SBWRJGPKZNEBGR-UHFFFAOYSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate (CAS: 90407-15-1)?

Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate (CAS: 90407-15-1) is a crystalline compound with a mol...

Compound Q&A

How is Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate (CAS: 90407-15-1) typically synthesized?

Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate (CAS: 90407-15-1) is typically synthesized via a multi...

Compound Q&A

What precautions should be taken when handling Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate (CAS: 90407-15-1)?

When handling Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate (CAS: 90407-15-1), it is crucial to foll...

Compound Q&A

What precautions should be taken when handling 4-(2-Furylmethyl)thiomorpholine 1,1-dioxide (CAS: 79206-94-3)?

When handling 4-(2-Furylmethyl)thiomorpholine 1,1-dioxide (CAS: 79206-94-3), it ...

79206-94-34-(2-Furylmethyl)thi...
Compound Q&A

What precautions should be taken when handling 4-Chloro-N-[2-(4-morpholinyl)ethyl]benzamide (CAS: 71320-77-9)?

When handling 4-Chloro-N-[2-(4-morpholinyl)ethyl]benzamide (CAS: 71320-77-9), it...

71320-77-94-Chloro-N-[2-(4-mor...
Compound Q&A

How should waste containing 2-[2-(2-Methoxyethoxy)ethoxy]ethyl 4-methylbenzenesulfonate (CAS: 62921-74-8) be handled?

Waste containing this compound (CAS: 62921-74-8) should be handled according to ...

62921-74-82-[2-(2-Methoxyethox...
Compound Q&A

How should waste containing (S)-Methyl 2-amino-3-cyclohexylpropanoate be handled?

Waste containing (S)-Methyl 2-amino-3-cyclohexylpropanoate should be collected i...

40056-18-6(S)-Methyl 2-amino-3...