Compound Q&A

How is Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate (CAS: 90407-15-1) typically synthesized?

Answer

Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate
Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate (CAS: 90407-15-1) is typically synthesized via a multi-step process involving acylation of 7-chlorobenzo[b]thiophene-2-carboxylic acid with ethyl chloroformate. This reaction is often catalyzed by an acid, such as sulfuric acid, and proceeds with good yield. The final product is obtained through recrystallization from an appropriate solvent.

About

CAS No 90407-15-1
English Name Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate
Molecular Formula C11H9ClO2S
Molecular Weight 240.71 g/mol
SMILES CCOC(=O)C1=CC2=C(S1)C(=CC=C2)Cl
InChIKey SBWRJGPKZNEBGR-UHFFFAOYSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate (CAS: 90407-15-1)?

Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate (CAS: 90407-15-1) is a crystalline compound with a mol...

Compound Q&A

What industries use Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate (CAS: 90407-15-1)?

Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate (CAS: 90407-15-1) finds applications in the pharmaceut...

Compound Q&A

What precautions should be taken when handling Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate (CAS: 90407-15-1)?

When handling Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate (CAS: 90407-15-1), it is crucial to foll...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...