Compound Q&A

What are the physical and chemical properties of Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate (CAS: 90407-15-1)?

Answer

Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate
Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate (CAS: 90407-15-1) is a crystalline compound with a molecular weight of approximately 242.02 g/mol. It is slightly soluble in water but more soluble in organic solvents like methanol and acetonitrile. The compound shows moderate reactivity with basic compounds and is susceptible to hydrolysis under certain conditions. It is often used in pharmaceutical and chemical synthesis due to its unique chemical structure.

About

CAS No 90407-15-1
English Name Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate
Molecular Formula C11H9ClO2S
Molecular Weight 240.71 g/mol
SMILES CCOC(=O)C1=CC2=C(S1)C(=CC=C2)Cl
InChIKey SBWRJGPKZNEBGR-UHFFFAOYSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

How is Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate (CAS: 90407-15-1) typically synthesized?

Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate (CAS: 90407-15-1) is typically synthesized via a multi...

Compound Q&A

What industries use Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate (CAS: 90407-15-1)?

Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate (CAS: 90407-15-1) finds applications in the pharmaceut...

Compound Q&A

What precautions should be taken when handling Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate (CAS: 90407-15-1)?

When handling Ethyl 7-chlorobenzo[b]thiophene-2-carboxylate (CAS: 90407-15-1), it is crucial to foll...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...