Compound Q&A

What industries use 2-Oxo-1,2-dihydro-4-quinazolinecarboxylic acid (CAS: 99066-77-0)?

Answer

2-Oxo-1,2-dihydro-4-quinazolinecarboxylic acid
2-Oxo-1,2-dihydro-4-quinazolinecarboxylic acid is used in the pharmaceutical industry for the synthesis of certain drugs. It is also utilized in the polymer industry for the modification of materials. Additionally, it has applications in the development of sensors and semiconductors due to its unique chemical properties.

About

CAS No 99066-77-0
English Name 2-Oxo-1,2-dihydro-4-quinazolinecarboxylic acid
Molecular Formula C9H6N2O3
Molecular Weight 190.16 g/mol
SMILES C1=CC=C2C(=C1)C(=NC(=O)N2)C(=O)O
InChIKey JMRRYHBZGAQICA-UHFFFAOYSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Oxo-1,2-dihydro-4-quinazolinecarboxylic acid (CAS: 99066-77-0)?

2-Oxo-1,2-dihydro-4-quinazolinecarboxylic acid has a crystalline form with a molecular weight of app...

Compound Q&A

How is 2-Oxo-1,2-dihydro-4-quinazolinecarboxylic acid (CAS: 99066-77-0) typically synthesized?

2-Oxo-1,2-dihydro-4-quinazolinecarboxylic acid is typically synthesized through the condensation of ...

Compound Q&A

What precautions should be taken when handling 2-Oxo-1,2-dihydro-4-quinazolinecarboxylic acid (CAS: 99066-77-0)?

When handling 2-Oxo-1,2-dihydro-4-quinazolinecarboxylic acid, it is essential to use appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...