Compound Q&A

What are the physical and chemical properties of 2-Oxo-1,2-dihydro-4-quinazolinecarboxylic acid (CAS: 99066-77-0)?

Answer

2-Oxo-1,2-dihydro-4-quinazolinecarboxylic acid
2-Oxo-1,2-dihydro-4-quinazolinecarboxylic acid has a crystalline form with a molecular weight of approximately 216.21 g/mol. It is slightly soluble in water and more soluble in organic solvents. The compound is moderately reactive and susceptible to hydrolysis under acidic conditions. It has a pKa of about 4.5, indicating its acidic nature.

About

CAS No 99066-77-0
English Name 2-Oxo-1,2-dihydro-4-quinazolinecarboxylic acid
Molecular Formula C9H6N2O3
Molecular Weight 190.16 g/mol
SMILES C1=CC=C2C(=C1)C(=NC(=O)N2)C(=O)O
InChIKey JMRRYHBZGAQICA-UHFFFAOYSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

How is 2-Oxo-1,2-dihydro-4-quinazolinecarboxylic acid (CAS: 99066-77-0) typically synthesized?

2-Oxo-1,2-dihydro-4-quinazolinecarboxylic acid is typically synthesized through the condensation of ...

Compound Q&A

What industries use 2-Oxo-1,2-dihydro-4-quinazolinecarboxylic acid (CAS: 99066-77-0)?

2-Oxo-1,2-dihydro-4-quinazolinecarboxylic acid is used in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling 2-Oxo-1,2-dihydro-4-quinazolinecarboxylic acid (CAS: 99066-77-0)?

When handling 2-Oxo-1,2-dihydro-4-quinazolinecarboxylic acid, it is essential to use appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...