Compound Q&A

What industries use 2-Methyl-2-propanyl (3S)-3-[4-(7-carbamoyl-2H-indazol-2-yl)phenyl]-1-piperidinecarboxylate (CAS: 1038916-11-8)?

Answer

2-Methyl-2-propanyl (3S)-3-[4-(7-carbamoyl-2H-indazol-2-yl)phenyl]-1-piperidinecarboxylate
This compound is primarily used in the pharmaceutical industry for the development of new drugs. It also has potential applications in the polymer industry for improving the properties of various polymers. Additionally, it may be used in the production of advanced sensors and semiconductors due to its chemical structure.

About

English Name 2-Methyl-2-propanyl (3S)-3-[4-(7-carbamoyl-2H-indazol-2-yl)phenyl]-1-piperidinecarboxylate
Molecular Formula C24H28N4O3
Molecular Weight 420.51 g/mol
SMILES O=C(N1CCC[C@H](C1)c1ccc(cc1)n1cc2c(n1)c(ccc2)C(=O)N)OC(C)(C)C
InChIKey CKLLYICRBHJGHU-QGZVFWFLSA-N
Last Updated: 2026-03-11 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (3S)-3-[4-(7-carbamoyl-2H-indazol-2-yl)phenyl]-1-piperidinecarboxylate (CAS: 1038916-11-8)?

2-Methyl-2-propanyl (3S)-3-[4-(7-carbamoyl-2H-indazol-2-yl)phenyl]-1-piperidinecarboxylate is a crys...

Compound Q&A

How is 2-Methyl-2-propanyl (3S)-3-[4-(7-carbamoyl-2H-indazol-2-yl)phenyl]-1-piperidinecarboxylate (CAS: 1038916-11-8) typically synthesized?

This compound is typically synthesized through multistep organic reactions involving the coupling of...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (3S)-3-[4-(7-carbamoyl-2H-indazol-2-yl)phenyl]-1-piperidinecarboxylate (CAS: 1038916-11-8)?

When handling this compound, it is important to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...