Compound Q&A

How is 2-Methyl-2-propanyl (3S)-3-[4-(7-carbamoyl-2H-indazol-2-yl)phenyl]-1-piperidinecarboxylate (CAS: 1038916-11-8) typically synthesized?

Answer

2-Methyl-2-propanyl (3S)-3-[4-(7-carbamoyl-2H-indazol-2-yl)phenyl]-1-piperidinecarboxylate
This compound is typically synthesized through multistep organic reactions involving the coupling of a piperidine derivative with a substituted indazolyl derivative. The synthesis often utilizes catalysts such as palladium complexes and bases like potassium carbonate. The reaction yields a mixture of isomers, with the (3S) isomer being the desired product.

About

English Name 2-Methyl-2-propanyl (3S)-3-[4-(7-carbamoyl-2H-indazol-2-yl)phenyl]-1-piperidinecarboxylate
Molecular Formula C24H28N4O3
Molecular Weight 420.51 g/mol
SMILES O=C(N1CCC[C@H](C1)c1ccc(cc1)n1cc2c(n1)c(ccc2)C(=O)N)OC(C)(C)C
InChIKey CKLLYICRBHJGHU-QGZVFWFLSA-N
Last Updated: 2026-03-11 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (3S)-3-[4-(7-carbamoyl-2H-indazol-2-yl)phenyl]-1-piperidinecarboxylate (CAS: 1038916-11-8)?

2-Methyl-2-propanyl (3S)-3-[4-(7-carbamoyl-2H-indazol-2-yl)phenyl]-1-piperidinecarboxylate is a crys...

Compound Q&A

What industries use 2-Methyl-2-propanyl (3S)-3-[4-(7-carbamoyl-2H-indazol-2-yl)phenyl]-1-piperidinecarboxylate (CAS: 1038916-11-8)?

This compound is primarily used in the pharmaceutical industry for the development of new drugs. It ...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (3S)-3-[4-(7-carbamoyl-2H-indazol-2-yl)phenyl]-1-piperidinecarboxylate (CAS: 1038916-11-8)?

When handling this compound, it is important to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...