Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (3S)-3-[4-(7-carbamoyl-2H-indazol-2-yl)phenyl]-1-piperidinecarboxylate (CAS: 1038916-11-8)?

Answer

2-Methyl-2-propanyl (3S)-3-[4-(7-carbamoyl-2H-indazol-2-yl)phenyl]-1-piperidinecarboxylate
2-Methyl-2-propanyl (3S)-3-[4-(7-carbamoyl-2H-indazol-2-yl)phenyl]-1-piperidinecarboxylate is a crystalline compound with a molecular weight of approximately 507.58 g/mol. It has limited water solubility and is generally stable under normal conditions. This compound exhibits limited reactivity, but care should be taken to avoid strong reducing agents and bases to prevent decomposition.

About

English Name 2-Methyl-2-propanyl (3S)-3-[4-(7-carbamoyl-2H-indazol-2-yl)phenyl]-1-piperidinecarboxylate
Molecular Formula C24H28N4O3
Molecular Weight 420.51 g/mol
SMILES O=C(N1CCC[C@H](C1)c1ccc(cc1)n1cc2c(n1)c(ccc2)C(=O)N)OC(C)(C)C
InChIKey CKLLYICRBHJGHU-QGZVFWFLSA-N
Last Updated: 2026-03-11 12:33

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl (3S)-3-[4-(7-carbamoyl-2H-indazol-2-yl)phenyl]-1-piperidinecarboxylate (CAS: 1038916-11-8) typically synthesized?

This compound is typically synthesized through multistep organic reactions involving the coupling of...

Compound Q&A

What industries use 2-Methyl-2-propanyl (3S)-3-[4-(7-carbamoyl-2H-indazol-2-yl)phenyl]-1-piperidinecarboxylate (CAS: 1038916-11-8)?

This compound is primarily used in the pharmaceutical industry for the development of new drugs. It ...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (3S)-3-[4-(7-carbamoyl-2H-indazol-2-yl)phenyl]-1-piperidinecarboxylate (CAS: 1038916-11-8)?

When handling this compound, it is important to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...