Compound Q&A

What industries use 3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline (CAS: 1332356-31-6)?

Answer

3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline
3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline (CAS: 1332356-31-6) is primarily used in the pharmaceutical industry for the development of novel drugs. It also finds applications in the synthesis of functional materials for sensors and semiconductors, where its unique chemical properties make it suitable for specific reactions and functionalities.

About

English Name 3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline
Molecular Formula C17H17F3N2
Molecular Weight 306.33 g/mol
SMILES c1cc(ccc1C2CCN(CC2)c3c(cc(cc3F)N)F)F
InChIKey IQFWNVBJEZXPAF-UHFFFAOYSA-N
Last Updated: 2026-03-11 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline (CAS: 1332356-31-6)?

3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline (CAS: 1332356-31-6) is a crystalline solid ...

Compound Q&A

How is 3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline (CAS: 1332356-31-6) typically synthesized?

3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline is typically synthesized via a multistep pr...

Compound Q&A

What precautions should be taken when handling 3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline (CAS: 1332356-31-6)?

When handling 3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline, it is crucial to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...