Compound Q&A

What are the physical and chemical properties of 3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline (CAS: 1332356-31-6)?

Answer

3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline
3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline (CAS: 1332356-31-6) is a crystalline solid with a molecular weight of approximately 411.33 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and dimethylformamide. Chemically, it is relatively stable but can react with strong acids and bases. It exhibits good reactivity in electrophilic aromatic substitution reactions.

About

English Name 3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline
Molecular Formula C17H17F3N2
Molecular Weight 306.33 g/mol
SMILES c1cc(ccc1C2CCN(CC2)c3c(cc(cc3F)N)F)F
InChIKey IQFWNVBJEZXPAF-UHFFFAOYSA-N
Last Updated: 2026-03-11 12:33

Related Q&A

Compound Q&A

How is 3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline (CAS: 1332356-31-6) typically synthesized?

3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline is typically synthesized via a multistep pr...

Compound Q&A

What industries use 3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline (CAS: 1332356-31-6)?

3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline (CAS: 1332356-31-6) is primarily used in th...

Compound Q&A

What precautions should be taken when handling 3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline (CAS: 1332356-31-6)?

When handling 3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline, it is crucial to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...