Compound Q&A

How is 3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline (CAS: 1332356-31-6) typically synthesized?

Answer

3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline
3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline is typically synthesized via a multistep process involving the formation of a piperidine ring, followed by coupling with a fluoroaniline derivative. The synthesis often employs palladium catalysts and involves protecting groups to control the selectivity. High yields and purity can be achieved with careful optimization of reaction conditions.

About

English Name 3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline
Molecular Formula C17H17F3N2
Molecular Weight 306.33 g/mol
SMILES c1cc(ccc1C2CCN(CC2)c3c(cc(cc3F)N)F)F
InChIKey IQFWNVBJEZXPAF-UHFFFAOYSA-N
Last Updated: 2026-03-11 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline (CAS: 1332356-31-6)?

3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline (CAS: 1332356-31-6) is a crystalline solid ...

Compound Q&A

What industries use 3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline (CAS: 1332356-31-6)?

3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline (CAS: 1332356-31-6) is primarily used in th...

Compound Q&A

What precautions should be taken when handling 3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline (CAS: 1332356-31-6)?

When handling 3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]aniline, it is crucial to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...