Compound Q&A

What precautions should be taken when handling 9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin (CAS: 1329833-82-0)?

Answer

9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin
When handling 9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin (CAS: 1329833-82-0), it is crucial to wear appropriate personal protective equipment (PPE), including gloves and safety goggles. It should be stored in a dry, cool place and away from strong acids and bases. In case of spills, immediately clean up the area using appropriate methods and ensure proper disposal. Always refer to the Safety Data Sheet (SDS) for detailed handling and safety information.

About

English Name 9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin
Molecular Formula C23H31N5O4
Molecular Weight 441.53 g/mol
SMILES CC1COC2=C3N1C=C(C(=O)C3=CC(=C2N4CCN(CC4)C)N5CCN(CC5)C)C(=O)O
InChIKey XWSLQLSKDDWMBP-UHFFFAOYSA-N
Last Updated: 2026-03-11 07:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin (CAS: 1329833-82-0)?

9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin (CAS: 1329833-82-0) is a crystalline solid with a...

Compound Q&A

How is 9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin (CAS: 1329833-82-0) typically synthesized?

9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin is typically synthesized via a multi-step process...

Compound Q&A

What industries use 9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin (CAS: 1329833-82-0)?

9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin (CAS: 1329833-82-0) is primarily used in the phar...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...