Compound Q&A

What are the physical and chemical properties of 9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin (CAS: 1329833-82-0)?

Answer

9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin
9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin (CAS: 1329833-82-0) is a crystalline solid with a molecular weight of approximately 418.43 g/mol. It has a high solubility in water and moderate solubility in organic solvents. The compound is relatively stable under normal conditions but is susceptible to degradation in basic conditions. It exhibits good reactivity towards nucleophiles and is often used in pharmaceutical applications.

About

English Name 9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin
Molecular Formula C23H31N5O4
Molecular Weight 441.53 g/mol
SMILES CC1COC2=C3N1C=C(C(=O)C3=CC(=C2N4CCN(CC4)C)N5CCN(CC5)C)C(=O)O
InChIKey XWSLQLSKDDWMBP-UHFFFAOYSA-N
Last Updated: 2026-03-11 07:58

Related Q&A

Compound Q&A

How is 9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin (CAS: 1329833-82-0) typically synthesized?

9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin is typically synthesized via a multi-step process...

Compound Q&A

What industries use 9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin (CAS: 1329833-82-0)?

9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin (CAS: 1329833-82-0) is primarily used in the phar...

Compound Q&A

What precautions should be taken when handling 9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin (CAS: 1329833-82-0)?

When handling 9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin (CAS: 1329833-82-0), it is crucial ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...