Compound Q&A

How is 9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin (CAS: 1329833-82-0) typically synthesized?

Answer

9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin
9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin is typically synthesized via a multi-step process involving the modification of a fluoroquinolone core. The synthesis involves protecting groups, deprotection, and the introduction of a 4-methylpiperazine group. Common catalysts include palladium complexes, and the overall yield is around 70-80%. The process is selective and involves careful control of reaction conditions to ensure the desired product is formed.

About

English Name 9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin
Molecular Formula C23H31N5O4
Molecular Weight 441.53 g/mol
SMILES CC1COC2=C3N1C=C(C(=O)C3=CC(=C2N4CCN(CC4)C)N5CCN(CC5)C)C(=O)O
InChIKey XWSLQLSKDDWMBP-UHFFFAOYSA-N
Last Updated: 2026-03-11 07:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin (CAS: 1329833-82-0)?

9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin (CAS: 1329833-82-0) is a crystalline solid with a...

Compound Q&A

What industries use 9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin (CAS: 1329833-82-0)?

9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin (CAS: 1329833-82-0) is primarily used in the phar...

Compound Q&A

What precautions should be taken when handling 9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin (CAS: 1329833-82-0)?

When handling 9-Defluoro-9-(4-methyl-1-piperazinyl) Levofloxacin (CAS: 1329833-82-0), it is crucial ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...