Compound Q&A

What industries use DoMperidoneiMpurityE (CAS: 1346602-50-3)?

Answer

DoMperidoneiMpurityE
DoMperidoneiMpurityE is primarily used in the pharmaceutical industry for the development of antipsychotic medications. It is also of interest in the research community for its potential applications in studies related to dopamine receptor function. Its use in other industries such as polymers and sensors is limited but ongoing research may expand its applications.

About

English Name DoMperidoneiMpurityE
Molecular Formula C32H34ClN7O3
Molecular Weight 600.11 g/mol
SMILES Clc1ccc2c(c1)[nH]c(=O)n2C1CCN(CC1)CCCn1c(=O)n(c2c1cccc2)CCCn1c(=O)[nH]c2c1cccc2
InChIKey RGMCTMMMTSTPET-UHFFFAOYSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of DoMperidoneiMpurityE (CAS: 1346602-50-3)?

DoMperidoneiMpurityE is an organic compound characterized by a crystalline form with a molecular wei...

Compound Q&A

How is DoMperidoneiMpurityE (CAS: 1346602-50-3) typically synthesized?

DoMperidoneiMpurityE is synthesized through a multi-step process involving the protection and modifi...

Compound Q&A

What precautions should be taken when handling DoMperidoneiMpurityE (CAS: 1346602-50-3)?

Handling DoMperidoneiMpurityE requires adherence to strict safety protocols. Always wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...