Compound Q&A

How is DoMperidoneiMpurityE (CAS: 1346602-50-3) typically synthesized?

Answer

DoMperidoneiMpurityE
DoMperidoneiMpurityE is synthesized through a multi-step process involving the protection and modification of a primary amine group. Commonly, this involves the use of a protecting group, followed by an amide formation step. The reaction typically uses a catalyst such as an acid or base, and the yield and selectivity vary depending on the specific conditions, with high purity products being obtained through recrystallization.

About

English Name DoMperidoneiMpurityE
Molecular Formula C32H34ClN7O3
Molecular Weight 600.11 g/mol
SMILES Clc1ccc2c(c1)[nH]c(=O)n2C1CCN(CC1)CCCn1c(=O)n(c2c1cccc2)CCCn1c(=O)[nH]c2c1cccc2
InChIKey RGMCTMMMTSTPET-UHFFFAOYSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of DoMperidoneiMpurityE (CAS: 1346602-50-3)?

DoMperidoneiMpurityE is an organic compound characterized by a crystalline form with a molecular wei...

Compound Q&A

What industries use DoMperidoneiMpurityE (CAS: 1346602-50-3)?

DoMperidoneiMpurityE is primarily used in the pharmaceutical industry for the development of antipsy...

Compound Q&A

What precautions should be taken when handling DoMperidoneiMpurityE (CAS: 1346602-50-3)?

Handling DoMperidoneiMpurityE requires adherence to strict safety protocols. Always wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...